C21H30N6 — CID 111973968
1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine (PubChem CID 111973968) has the molecular formula C21H30N6 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111973968 |
| Molecular Formula | C21H30N6 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]-2-[3-(1-methylpyrazol-4-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1cnn(C)c1)NCCc1c[nH]c2cc(C)ccc12 |
| InChI | InChI=1S/C21H30N6/c1-4-22-21(23-10-5-6-17-13-26-27(3)15-17)24-11-9-18-14-25-20-12-16(2)7-8-19(18)20/h7-8,12-15,25H,4-6,9-11H2,1-3H3,(H2,22,23,24) |
| InChIKey | UTBUIWAFNJSBRG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|