C25H30N6 — CID 111974271
1-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111974271) has the molecular formula C25H30N6 and a molecular weight of 414.56 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111974271 |
| Molecular Formula | C25H30N6 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 1-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cn2ccnc2)cc1)NCCc1c[nH]c2cc(C)ccc12 |
| InChI | InChI=1S/C25H30N6/c1-3-27-25(28-11-10-22-16-29-24-14-19(2)4-9-23(22)24)30-15-20-5-7-21(8-6-20)17-31-13-12-26-18-31/h4-9,12-14,16,18,29H,3,10-11,15,17H2,1-2H3,(H2,27,28,30) |
| InChIKey | GJZQMGRROVWLCG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|