C24H27FN6 — CID 111888813
1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111888813) has the molecular formula C24H27FN6 and a molecular weight of 418.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111888813 |
| Molecular Formula | C24H27FN6 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cn2ccnc2)cc1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C24H27FN6/c1-2-27-24(28-10-9-20-15-29-23-13-21(25)7-8-22(20)23)30-14-18-3-5-19(6-4-18)16-31-12-11-26-17-31/h3-8,11-13,15,17,29H,2,9-10,14,16H2,1H3,(H2,27,28,30) |
| InChIKey | WERIROGHWPHQSX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|