C21H23F2N5 — CID 111903051
1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111903051) has the molecular formula C21H23F2N5 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111903051 |
| Molecular Formula | C21H23F2N5 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[[4-(imidazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cn2ccnc2)cc1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C21H23F2N5/c1-2-25-21(27-13-18-11-19(22)7-8-20(18)23)26-12-16-3-5-17(6-4-16)14-28-10-9-24-15-28/h3-11,15H,2,12-14H2,1H3,(H2,25,26,27) |
| InChIKey | LUCWREGDIODNTM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|