C26H29N5O2 — CID 111974104
N-[4-[[[ethylamino-[2-(6-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 111974104) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[4-[[[ethylamino-[2-(6-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[[ethylamino-[2-(6-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111974104 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | N-[4-[[[ethylamino-[2-(6-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)c2ccco2)cc1)NCCc1c[nH]c2cc(C)ccc12 |
| InChI | InChI=1S/C26H29N5O2/c1-3-27-26(28-13-12-20-17-29-23-15-18(2)6-11-22(20)23)30-16-19-7-9-21(10-8-19)31-25(32)24-5-4-14-33-24/h4-11,14-15,17,29H,3,12-13,16H2,1-2H3,(H,31,32)(H2,27,28,30) |
| InChIKey | MZCYTQZRXRCNME-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|