C23H27IN4O2S — CID 111372422
N-[4-[[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111372422) has the molecular formula C23H27IN4O2S and a molecular weight of 550.47 g/mol. Its IUPAC name is N-[4-[[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111372422 |
| Molecular Formula | C23H27IN4O2S |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | N-[4-[[[ethylamino-(2-phenylsulfanylethylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)c2ccco2)cc1)NCCSc1ccccc1.I |
| InChI | InChI=1S/C23H26N4O2S.HI/c1-2-24-23(25-14-16-30-20-7-4-3-5-8-20)26-17-18-10-12-19(13-11-18)27-22(28)21-9-6-15-29-21;/h3-13,15H,2,14,16-17H2,1H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | NNSXFYSNEPGHLF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|