C22H30IN5O — CID 111974254
2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111974254) has the molecular formula C22H30IN5O and a molecular weight of 507.42 g/mol. Its IUPAC name is 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111974254 |
| Molecular Formula | C22H30IN5O |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 2-[(2-ethoxy-3-pyridinyl)methyl]-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OCC)NCCc1c[nH]c2cc(C)ccc12.I |
| InChI | InChI=1S/C22H29N5O.HI/c1-4-23-22(27-15-18-7-6-11-24-21(18)28-5-2)25-12-10-17-14-26-20-13-16(3)8-9-19(17)20;/h6-9,11,13-14,26H,4-5,10,12,15H2,1-3H3,(H2,23,25,27);1H |
| InChIKey | PKDZJBGJVWJCMK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|