C23H29FN4O2S — CID 111887827
2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111887827) has the molecular formula C23H29FN4O2S and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111887827 |
| Molecular Formula | C23H29FN4O2S |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCCS(=O)(=O)Cc1ccccc1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C23H29FN4O2S/c1-2-25-23(26-12-6-14-31(29,30)17-18-7-4-3-5-8-18)27-13-11-19-16-28-22-15-20(24)9-10-21(19)22/h3-5,7-10,15-16,28H,2,6,11-14,17H2,1H3,(H2,25,26,27) |
| InChIKey | ZRRPLRXYWBQBBM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|