C17H30N4 — CID 111127142
2-[3-[benzyl(methyl)amino]propyl]-1-ethyl-3-propan-2-ylguanidine (PubChem CID 111127142) has the molecular formula C17H30N4 and a molecular weight of 290.46 g/mol. Its IUPAC name is 2-[3-[benzyl(methyl)amino]propyl]-1-ethyl-3-propan-2-ylguanidine.
| Compound Name | 2-[3-[benzyl(methyl)amino]propyl]-1-ethyl-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111127142 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 2-[3-[benzyl(methyl)amino]propyl]-1-ethyl-3-propan-2-ylguanidine |
| SMILES | CCN/C(=N\CCCN(C)Cc1ccccc1)NC(C)C |
| InChI | InChI=1S/C17H30N4/c1-5-18-17(20-15(2)3)19-12-9-13-21(4)14-16-10-7-6-8-11-16/h6-8,10-11,15H,5,9,12-14H2,1-4H3,(H2,18,19,20) |
| InChIKey | DXIKVMYKCANSPD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|