C20H27F3IN5 — CID 111421314
1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111421314) has the molecular formula C20H27F3IN5 and a molecular weight of 521.37 g/mol. Its IUPAC name is 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111421314 |
| Molecular Formula | C20H27F3IN5 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(F)(F)F)cc1)NCCCCNc1ccccn1.I |
| InChI | InChI=1S/C20H26F3N5.HI/c1-2-24-19(27-14-6-5-13-26-18-7-3-4-12-25-18)28-15-16-8-10-17(11-9-16)20(21,22)23;/h3-4,7-12H,2,5-6,13-15H2,1H3,(H,25,26)(H2,24,27,28);1H |
| InChIKey | ALFIJDTURCNGQX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|