C20H29N5 — CID 111899717
1-ethyl-2-[(3-methylphenyl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine (PubChem CID 111899717) has the molecular formula C20H29N5 and a molecular weight of 339.49 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methylphenyl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine.
| Compound Name | 1-ethyl-2-[(3-methylphenyl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine |
|---|---|
| PubChem CID | 111899717 |
| Molecular Formula | C20H29N5 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 1-ethyl-2-[(3-methylphenyl)methyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(C)c1)NCCCCNc1ccccn1 |
| InChI | InChI=1S/C20H29N5/c1-3-21-20(25-16-18-10-8-9-17(2)15-18)24-14-7-6-13-23-19-11-4-5-12-22-19/h4-5,8-12,15H,3,6-7,13-14,16H2,1-2H3,(H,22,23)(H2,21,24,25) |
| InChIKey | CICIVNDMNRSJLB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|