C22H33N5O3 — CID 111378087
1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine (PubChem CID 111378087) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111378087 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCCCCNc1ccccn1 |
| InChI | InChI=1S/C22H33N5O3/c1-5-23-22(26-13-9-8-12-25-20-10-6-7-11-24-20)27-16-17-14-18(28-2)21(30-4)19(15-17)29-3/h6-7,10-11,14-15H,5,8-9,12-13,16H2,1-4H3,(H,24,25)(H2,23,26,27) |
| InChIKey | SOZLLSKBLAAJGH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|