C15H27N5 — CID 110919594
N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-methylpiperidine-1-carboximidamide (PubChem CID 110919594) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110919594 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-4-methylpiperidine-1-carboximidamide |
| SMILES | Cc1cc(C)n(CCC/N=C(\N)N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C15H27N5/c1-12-5-9-19(10-6-12)15(16)17-7-4-8-20-14(3)11-13(2)18-20/h11-12H,4-10H2,1-3H3,(H2,16,17) |
| InChIKey | PGKQCJWWBXETBS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|