C13H23IN4S2 — CID 111465995
4-methyl-N'-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111465995) has the molecular formula C13H23IN4S2 and a molecular weight of 426.39 g/mol. Its IUPAC name is 4-methyl-N'-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-methyl-N'-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111465995 |
| Molecular Formula | C13H23IN4S2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 4-methyl-N'-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCN(/C(N)=N/CCCSc2nccs2)CC1.I |
| InChI | InChI=1S/C13H22N4S2.HI/c1-11-3-7-17(8-4-11)12(14)15-5-2-9-18-13-16-6-10-19-13;/h6,10-11H,2-5,7-9H2,1H3,(H2,14,15);1H |
| InChIKey | JUANRVIFCBNAPV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|