C7H12N4S2 — CID 111465994
2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine (PubChem CID 111465994) has the molecular formula C7H12N4S2 and a molecular weight of 216.34 g/mol. Its IUPAC name is 2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine.
| Compound Name | 2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
|---|---|
| PubChem CID | 111465994 |
| Molecular Formula | C7H12N4S2 |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
| SMILES | NC(N)=NCCCSc1nccs1 |
| InChI | InChI=1S/C7H12N4S2/c8-6(9)10-2-1-4-12-7-11-3-5-13-7/h3,5H,1-2,4H2,(H4,8,9,10) |
| InChIKey | RGVILYJSKZXUQA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|