C17H23FIN5S2 — CID 111812281
4-(4-fluorophenyl)-N'-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111812281) has the molecular formula C17H23FIN5S2 and a molecular weight of 507.44 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-fluorophenyl)-N'-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111812281 |
| Molecular Formula | C17H23FIN5S2 |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCCSc1nccs1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H22FN5S2.HI/c18-14-2-4-15(5-3-14)22-8-10-23(11-9-22)16(19)20-6-1-12-24-17-21-7-13-25-17;/h2-5,7,13H,1,6,8-12H2,(H2,19,20);1H |
| InChIKey | LGBIDRBACVTNGF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|