C11H18N4S2 — CID 111812278
2-(2-methylprop-2-enyl)-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine (PubChem CID 111812278) has the molecular formula C11H18N4S2 and a molecular weight of 270.43 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine.
| Compound Name | 2-(2-methylprop-2-enyl)-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
|---|---|
| PubChem CID | 111812278 |
| Molecular Formula | C11H18N4S2 |
| Molecular Weight | 270.43 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]guanidine |
| SMILES | C=C(C)C/N=C(\N)NCCCSc1nccs1 |
| InChI | InChI=1S/C11H18N4S2/c1-9(2)8-15-10(12)13-4-3-6-16-11-14-5-7-17-11/h5,7H,1,3-4,6,8H2,2H3,(H3,12,13,15) |
| InChIKey | OYRFCPUANWIGCD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|