C10H18N2S2 — CID 115721327
N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]butan-2-amine (PubChem CID 115721327) has the molecular formula C10H18N2S2 and a molecular weight of 230.40 g/mol. Its IUPAC name is N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]butan-2-amine.
| Compound Name | N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]butan-2-amine |
|---|---|
| PubChem CID | 115721327 |
| Molecular Formula | C10H18N2S2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]butan-2-amine |
| SMILES | CCC(C)NCCCSc1nccs1 |
| InChI | InChI=1S/C10H18N2S2/c1-3-9(2)11-5-4-7-13-10-12-6-8-14-10/h6,8-9,11H,3-5,7H2,1-2H3 |
| InChIKey | XMUQXWSNOBOACS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|