C10H15N3S2 — CID 63054268
2-(propylamino)-4-(1,3-thiazol-2-ylsulfanyl)butanenitrile (PubChem CID 63054268) has the molecular formula C10H15N3S2 and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-(propylamino)-4-(1,3-thiazol-2-ylsulfanyl)butanenitrile.
| Compound Name | 2-(propylamino)-4-(1,3-thiazol-2-ylsulfanyl)butanenitrile |
|---|---|
| PubChem CID | 63054268 |
| Molecular Formula | C10H15N3S2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-(propylamino)-4-(1,3-thiazol-2-ylsulfanyl)butanenitrile |
| SMILES | CCCNC(C#N)CCSc1nccs1 |
| InChI | InChI=1S/C10H15N3S2/c1-2-4-12-9(8-11)3-6-14-10-13-5-7-15-10/h5,7,9,12H,2-4,6H2,1H3 |
| InChIKey | ITXNQWOGDFQSSM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|