About 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile
2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile (PubChem CID 63055136) has the molecular formula C9H14N4S2
and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile.
Molecular Properties
| Compound Name | 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile |
| PubChem CID | 63055136 |
| Molecular Formula | C9H14N4S2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile |
| SMILES | CCCNC(C#N)CCSc1nncs1 |
| InChI | InChI=1S/C9H14N4S2/c1-2-4-11-8(6-10)3-5-14-9-13-12-7-15-9/h7-8,11H,2-5H2,1H3 |
| InChIKey | GHTLFRVIEOVMLI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile?
The IUPAC name of 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile (CID 63055136) is 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile.
What is the SMILES notation for 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile?
The canonical SMILES for 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile is CCCNC(C#N)CCSc1nncs1.
What is the InChIKey of 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile?
The InChIKey is GHTLFRVIEOVMLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4S2/c1-2-4-11-8(6-10)3-5-14-9-13-12-7-15-9/h7-8,11H,2-5H2,1H3.
What are the key properties of 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile?
2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile has a molecular weight of 242.37 g/mol, XLogP of 1.91, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propylamino)-4-(1,3,4-thiadiazol-2-ylsulfanyl)butanenitrile is sourced from PubChem (CID 63055136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).