C8H15N3S2 — CID 61386355
N-propan-2-yl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-1-amine (PubChem CID 61386355) has the molecular formula C8H15N3S2 and a molecular weight of 217.36 g/mol. Its IUPAC name is N-propan-2-yl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-1-amine.
| Compound Name | N-propan-2-yl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-1-amine |
|---|---|
| PubChem CID | 61386355 |
| Molecular Formula | C8H15N3S2 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | N-propan-2-yl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-1-amine |
| SMILES | CC(C)NCCCSc1nncs1 |
| InChI | InChI=1S/C8H15N3S2/c1-7(2)9-4-3-5-12-8-11-10-6-13-8/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | OJUOJDPCSKVCTP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|