C12H22N2S2 — CID 115721318
3-methyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]pentan-2-amine (PubChem CID 115721318) has the molecular formula C12H22N2S2 and a molecular weight of 258.46 g/mol. Its IUPAC name is 3-methyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]pentan-2-amine.
| Compound Name | 3-methyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]pentan-2-amine |
|---|---|
| PubChem CID | 115721318 |
| Molecular Formula | C12H22N2S2 |
| Molecular Weight | 258.46 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-methyl-N-[3-(1,3-thiazol-2-ylsulfanyl)propyl]pentan-2-amine |
| SMILES | CCC(C)C(C)NCCCSc1nccs1 |
| InChI | InChI=1S/C12H22N2S2/c1-4-10(2)11(3)13-6-5-8-15-12-14-7-9-16-12/h7,9-11,13H,4-6,8H2,1-3H3 |
| InChIKey | CUVNTRXMBRZUNJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|