C17H24N2S2 — CID 64626706
N-[1-(4-propan-2-ylphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethyl]propan-1-amine (PubChem CID 64626706) has the molecular formula C17H24N2S2 and a molecular weight of 320.53 g/mol. Its IUPAC name is N-[1-(4-propan-2-ylphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-propan-2-ylphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 64626706 |
| Molecular Formula | C17H24N2S2 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[1-(4-propan-2-ylphenyl)-2-(1,3-thiazol-2-ylsulfanyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CSc1nccs1)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H24N2S2/c1-4-9-18-16(12-21-17-19-10-11-20-17)15-7-5-14(6-8-15)13(2)3/h5-8,10-11,13,16,18H,4,9,12H2,1-3H3 |
| InChIKey | SIOVTYOFQLOZRC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|