C6H10N2S2 — CID 64628516
1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine (PubChem CID 64628516) has the molecular formula C6H10N2S2 and a molecular weight of 174.29 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine.
| Compound Name | 1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 64628516 |
| Molecular Formula | C6H10N2S2 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine |
| SMILES | CC(N)CSc1nccs1 |
| InChI | InChI=1S/C6H10N2S2/c1-5(7)4-10-6-8-2-3-9-6/h2-3,5H,4,7H2,1H3 |
| InChIKey | GGDXYVBRXCUABV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|