C13H12N2OS2 — CID 64626110
1-(1-benzofuran-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanamine (PubChem CID 64626110) has the molecular formula C13H12N2OS2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanamine.
| Compound Name | 1-(1-benzofuran-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 64626110 |
| Molecular Formula | C13H12N2OS2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-(1,3-thiazol-2-ylsulfanyl)ethanamine |
| SMILES | NC(CSc1nccs1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C13H12N2OS2/c14-10(8-18-13-15-5-6-17-13)12-7-9-3-1-2-4-11(9)16-12/h1-7,10H,8,14H2 |
| InChIKey | AAURAGJVJOHEKX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|