methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate

C8H12N2O2S2 — CID 63034527

IUPACmethyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate
SMILESCOC(=O)C(N)CCSc1nccs1
InChIInChI=1S/C8H12N2O2S2/c1-12-7(11)6(9)2-4-13-8-10-3-5-14-8/h3,5-6H,2,4,9H2,1H3
InChIKeyGPPUTJPVBBLXFA-UHFFFAOYSA-N
MW232.33 g/mol
LogP1.13
Rot. Bonds5

About methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate

methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate (PubChem CID 63034527) has the molecular formula C8H12N2O2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate.

Molecular Properties

Compound Namemethyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate
PubChem CID63034527
Molecular FormulaC8H12N2O2S2
Molecular Weight232.33 g/mol
Exact Mass232.03
IUPAC Namemethyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate
SMILESCOC(=O)C(N)CCSc1nccs1
InChIInChI=1S/C8H12N2O2S2/c1-12-7(11)6(9)2-4-13-8-10-3-5-14-8/h3,5-6H,2,4,9H2,1H3
InChIKeyGPPUTJPVBBLXFA-UHFFFAOYSA-N
XLogP1.13
TPSA65.21 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.33
LogP ≤ 51.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}

Analyze methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate?
The IUPAC name of methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate (CID 63034527) is methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate.
What is the SMILES notation for methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate?
The canonical SMILES for methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate is COC(=O)C(N)CCSc1nccs1.
What is the InChIKey of methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate?
The InChIKey is GPPUTJPVBBLXFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S2/c1-12-7(11)6(9)2-4-13-8-10-3-5-14-8/h3,5-6H,2,4,9H2,1H3.
What are the key properties of methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate?
methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate has a molecular weight of 232.33 g/mol, XLogP of 1.13, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate is sourced from PubChem (CID 63034527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).