C8H12N2O2S2 — CID 63034527
methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate (PubChem CID 63034527) has the molecular formula C8H12N2O2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate.
| Compound Name | methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 63034527 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | methyl 2-amino-4-(1,3-thiazol-2-ylsulfanyl)butanoate |
| SMILES | COC(=O)C(N)CCSc1nccs1 |
| InChI | InChI=1S/C8H12N2O2S2/c1-12-7(11)6(9)2-4-13-8-10-3-5-14-8/h3,5-6H,2,4,9H2,1H3 |
| InChIKey | GPPUTJPVBBLXFA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|