C14H16N2O2S2 — CID 116694693
methyl 2-amino-2-phenyl-4-(1,3-thiazol-2-ylsulfanyl)butanoate (PubChem CID 116694693) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is methyl 2-amino-2-phenyl-4-(1,3-thiazol-2-ylsulfanyl)butanoate.
| Compound Name | methyl 2-amino-2-phenyl-4-(1,3-thiazol-2-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 116694693 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | methyl 2-amino-2-phenyl-4-(1,3-thiazol-2-ylsulfanyl)butanoate |
| SMILES | COC(=O)C(N)(CCSc1nccs1)c1ccccc1 |
| InChI | InChI=1S/C14H16N2O2S2/c1-18-12(17)14(15,11-5-3-2-4-6-11)7-9-19-13-16-8-10-20-13/h2-6,8,10H,7,9,15H2,1H3 |
| InChIKey | IREGIYYQWMEDBD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|