C15H18N2O4 — CID 116694039
methyl 2-amino-4-(2,5-dioxopyrrolidin-1-yl)-2-phenylbutanoate (PubChem CID 116694039) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 2-amino-4-(2,5-dioxopyrrolidin-1-yl)-2-phenylbutanoate.
| Compound Name | methyl 2-amino-4-(2,5-dioxopyrrolidin-1-yl)-2-phenylbutanoate |
|---|---|
| PubChem CID | 116694039 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl 2-amino-4-(2,5-dioxopyrrolidin-1-yl)-2-phenylbutanoate |
| SMILES | COC(=O)C(N)(CCN1C(=O)CCC1=O)c1ccccc1 |
| InChI | InChI=1S/C15H18N2O4/c1-21-14(20)15(16,11-5-3-2-4-6-11)9-10-17-12(18)7-8-13(17)19/h2-6H,7-10,16H2,1H3 |
| InChIKey | UBHDLMOBYLSOQL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|