C16H24N2O3 — CID 116693847
methyl 2-amino-4-(1,4-oxazepan-4-yl)-2-phenylbutanoate (PubChem CID 116693847) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 2-amino-4-(1,4-oxazepan-4-yl)-2-phenylbutanoate.
| Compound Name | methyl 2-amino-4-(1,4-oxazepan-4-yl)-2-phenylbutanoate |
|---|---|
| PubChem CID | 116693847 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | methyl 2-amino-4-(1,4-oxazepan-4-yl)-2-phenylbutanoate |
| SMILES | COC(=O)C(N)(CCN1CCCOCC1)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O3/c1-20-15(19)16(17,14-6-3-2-4-7-14)8-10-18-9-5-12-21-13-11-18/h2-4,6-7H,5,8-13,17H2,1H3 |
| InChIKey | LDGNXSWBPFJBPG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |