C17H24N2O4 — CID 176955961
benzyl (2R)-2-amino-2-methyl-4-(1,4-oxazepan-4-yl)-3-oxobutanoate (PubChem CID 176955961) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is benzyl (2R)-2-amino-2-methyl-4-(1,4-oxazepan-4-yl)-3-oxobutanoate.
| Compound Name | benzyl (2R)-2-amino-2-methyl-4-(1,4-oxazepan-4-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 176955961 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | benzyl (2R)-2-amino-2-methyl-4-(1,4-oxazepan-4-yl)-3-oxobutanoate |
| SMILES | C[C@@](N)(C(=O)CN1CCCOCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O4/c1-17(18,15(20)12-19-8-5-10-22-11-9-19)16(21)23-13-14-6-3-2-4-7-14/h2-4,6-7H,5,8-13,18H2,1H3/t17-/m1/s1 |
| InChIKey | QXABWRSCABJBIA-QGZVFWFLSA-N |
| XLogP | 0.74 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|