C20H30N2O5 — CID 10595823
tert-butyl (2S)-4-morpholin-4-yl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 10595823) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is tert-butyl (2S)-4-morpholin-4-yl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | tert-butyl (2S)-4-morpholin-4-yl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 10595823 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | tert-butyl (2S)-4-morpholin-4-yl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCN1CCOCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H30N2O5/c1-20(2,3)27-18(23)17(9-10-22-11-13-25-14-12-22)21-19(24)26-15-16-7-5-4-6-8-16/h4-8,17H,9-15H2,1-3H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | BROCUHCHLJFZFZ-KRWDZBQOSA-N |
| XLogP | 2.35 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |