C24H31N3O4 — CID 52532454
benzyl N-[(2S)-1-[methyl(2-morpholin-4-ylethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 52532454) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[methyl(2-morpholin-4-ylethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[methyl(2-morpholin-4-ylethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 52532454 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | benzyl N-[(2S)-1-[methyl(2-morpholin-4-ylethyl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CN(CCN1CCOCC1)C(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H31N3O4/c1-26(12-13-27-14-16-30-17-15-27)23(28)22(18-20-8-4-2-5-9-20)25-24(29)31-19-21-10-6-3-7-11-21/h2-11,22H,12-19H2,1H3,(H,25,29)/t22-/m0/s1 |
| InChIKey | HMTDVOQUZLPTPO-QFIPXVFZSA-N |
| XLogP | 2.31 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |