C20H24N4O3S — CID 162421352
benzyl N-[(2S)-1-[[carbamothioyl(methyl)amino]-methylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 162421352) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[carbamothioyl(methyl)amino]-methylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[carbamothioyl(methyl)amino]-methylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 162421352 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | benzyl N-[(2S)-1-[[carbamothioyl(methyl)amino]-methylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CN(C(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)N(C)C(N)=S |
| InChI | InChI=1S/C20H24N4O3S/c1-23(24(2)19(21)28)18(25)17(13-15-9-5-3-6-10-15)22-20(26)27-14-16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3,(H2,21,28)(H,22,26)/t17-/m0/s1 |
| InChIKey | ZDTPPCXAWKSVKT-KRWDZBQOSA-N |
| XLogP | 2.07 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|