C14H19N3O4 — CID 102329953
benzyl N-[(2S)-4-amino-1-(dimethylamino)-1,4-dioxobutan-2-yl]carbamate (PubChem CID 102329953) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is benzyl N-[(2S)-4-amino-1-(dimethylamino)-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-4-amino-1-(dimethylamino)-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 102329953 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | benzyl N-[(2S)-4-amino-1-(dimethylamino)-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CN(C)C(=O)[C@H](CC(N)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H19N3O4/c1-17(2)13(19)11(8-12(15)18)16-14(20)21-9-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3,(H2,15,18)(H,16,20)/t11-/m0/s1 |
| InChIKey | OLYHXBXJBSBJMU-NSHDSACASA-N |
| XLogP | 0.25 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |