C14H18N2O4 — CID 90925413
benzyl N-[1-(dimethylamino)-1,4-dioxobutan-2-yl]carbamate (PubChem CID 90925413) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is benzyl N-[1-(dimethylamino)-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(dimethylamino)-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 90925413 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | benzyl N-[1-(dimethylamino)-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CN(C)C(=O)C(CC=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H18N2O4/c1-16(2)13(18)12(8-9-17)15-14(19)20-10-11-6-4-3-5-7-11/h3-7,9,12H,8,10H2,1-2H3,(H,15,19) |
| InChIKey | GSZDROGPUHSKGL-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|