C31H42N4O6 — CID 10483050
benzyl N-[(2S)-4-methyl-1-[[(2S)-4-(3-morpholin-4-ylpropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 10483050) has the molecular formula C31H42N4O6 and a molecular weight of 566.70 g/mol. Its IUPAC name is benzyl N-[(2S)-4-methyl-1-[[(2S)-4-(3-morpholin-4-ylpropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-4-methyl-1-[[(2S)-4-(3-morpholin-4-ylpropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 10483050 |
| Molecular Formula | C31H42N4O6 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | benzyl N-[(2S)-4-methyl-1-[[(2S)-4-(3-morpholin-4-ylpropylamino)-3,4-dioxo-1-phenylbutan-2-yl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C31H42N4O6/c1-23(2)20-27(34-31(39)41-22-25-12-7-4-8-13-25)29(37)33-26(21-24-10-5-3-6-11-24)28(36)30(38)32-14-9-15-35-16-18-40-19-17-35/h3-8,10-13,23,26-27H,9,14-22H2,1-2H3,(H,32,38)(H,33,37)(H,34,39)/t26-,27-/m0/s1 |
| InChIKey | SOPMJELGLOZMNK-SVBPBHIXSA-N |
| XLogP | 2.46 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|