C20H24N2O2 — CID 24840208
4-morpholin-4-yl-2,2-diphenylbutanamide (PubChem CID 24840208) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-morpholin-4-yl-2,2-diphenylbutanamide.
| Compound Name | 4-morpholin-4-yl-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 24840208 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 4-morpholin-4-yl-2,2-diphenylbutanamide |
| SMILES | NC(=O)C(CCN1CCOCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O2/c21-19(23)20(17-7-3-1-4-8-17,18-9-5-2-6-10-18)11-12-22-13-15-24-16-14-22/h1-10H,11-16H2,(H2,21,23) |
| InChIKey | JWGCCBRKRHIHTF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |