C20H26N4O — CID 10315097
4-(4-methylpiperazin-1-yl)-2-phenyl-2-pyridin-2-ylbutanamide (PubChem CID 10315097) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-2-phenyl-2-pyridin-2-ylbutanamide.
| Compound Name | 4-(4-methylpiperazin-1-yl)-2-phenyl-2-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 10315097 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-2-phenyl-2-pyridin-2-ylbutanamide |
| SMILES | CN1CCN(CCC(C(N)=O)(c2ccccc2)c2ccccn2)CC1 |
| InChI | InChI=1S/C20H26N4O/c1-23-13-15-24(16-14-23)12-10-20(19(21)25,17-7-3-2-4-8-17)18-9-5-6-11-22-18/h2-9,11H,10,12-16H2,1H3,(H2,21,25) |
| InChIKey | SBAVRZKJAMPTRY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |