C20H23N3O5S — CID 74221742
4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;sulfuric acid (PubChem CID 74221742) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;sulfuric acid.
| Compound Name | 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;sulfuric acid |
|---|---|
| PubChem CID | 74221742 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;sulfuric acid |
| SMILES | Cc1nccn1CCC(C(N)=O)(c1ccccc1)c1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/C20H21N3O.H2O4S/c1-16-22-13-15-23(16)14-12-20(19(21)24,17-8-4-2-5-9-17)18-10-6-3-7-11-18;1-5(2,3)4/h2-11,13,15H,12,14H2,1H3,(H2,21,24);(H2,1,2,3,4) |
| InChIKey | GRURFYWMRAYICX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|