C18H22ClNO — CID 142429226
2,2-diphenylhexanamide;hydrochloride (PubChem CID 142429226) has the molecular formula C18H22ClNO and a molecular weight of 303.83 g/mol. Its IUPAC name is 2,2-diphenylhexanamide;hydrochloride.
| Compound Name | 2,2-diphenylhexanamide;hydrochloride |
|---|---|
| PubChem CID | 142429226 |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2,2-diphenylhexanamide;hydrochloride |
| SMILES | CCCCC(C(N)=O)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C18H21NO.ClH/c1-2-3-14-18(17(19)20,15-10-6-4-7-11-15)16-12-8-5-9-13-16;/h4-13H,2-3,14H2,1H3,(H2,19,20);1H |
| InChIKey | IRSBSYDTPITFSR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |