C30H41NO — CID 122703905
(9Z,12Z)-2,2-diphenyloctadeca-9,12-dienamide (PubChem CID 122703905) has the molecular formula C30H41NO and a molecular weight of 431.66 g/mol. Its IUPAC name is (9Z,12Z)-2,2-diphenyloctadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-2,2-diphenyloctadeca-9,12-dienamide |
|---|---|
| PubChem CID | 122703905 |
| Molecular Formula | C30H41NO |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | (9Z,12Z)-2,2-diphenyloctadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC(C(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-21-26-30(29(31)32,27-22-17-15-18-23-27)28-24-19-16-20-25-28/h6-7,9-10,15-20,22-25H,2-5,8,11-14,21,26H2,1H3,(H2,31,32)/b7-6-,10-9- |
| InChIKey | ZGCWIXDVFBCRQH-HZJYTTRNSA-N |
| XLogP | 7.88 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|