C27H45NO — CID 174358193
(Z)-N-(2-phenylpropan-2-yl)octadec-9-enamide (PubChem CID 174358193) has the molecular formula C27H45NO and a molecular weight of 399.66 g/mol. Its IUPAC name is (Z)-N-(2-phenylpropan-2-yl)octadec-9-enamide.
| Compound Name | (Z)-N-(2-phenylpropan-2-yl)octadec-9-enamide |
|---|---|
| PubChem CID | 174358193 |
| Molecular Formula | C27H45NO |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 399.35 |
| IUPAC Name | (Z)-N-(2-phenylpropan-2-yl)octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C27H45NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-26(29)28-27(2,3)25-22-19-18-20-23-25/h11-12,18-20,22-23H,4-10,13-17,21,24H2,1-3H3,(H,28,29)/b12-11- |
| InChIKey | OVIQWBYATLZRSS-QXMHVHEDSA-N |
| XLogP | 8.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|