C21H27NO — CID 139775131
N-(1,2-diphenylpropan-2-yl)hexanamide (PubChem CID 139775131) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is N-(1,2-diphenylpropan-2-yl)hexanamide.
| Compound Name | N-(1,2-diphenylpropan-2-yl)hexanamide |
|---|---|
| PubChem CID | 139775131 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-(1,2-diphenylpropan-2-yl)hexanamide |
| SMILES | CCCCCC(=O)NC(C)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO/c1-3-4-7-16-20(23)22-21(2,19-14-10-6-11-15-19)17-18-12-8-5-9-13-18/h5-6,8-15H,3-4,7,16-17H2,1-2H3,(H,22,23) |
| InChIKey | SASXBWUEBJLBLV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|