C21H24N2O5 — CID 3088651
2-amino-N-(1,2-diphenylpropan-2-yl)acetamide;but-2-enedioic acid (PubChem CID 3088651) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-amino-N-(1,2-diphenylpropan-2-yl)acetamide;but-2-enedioic acid.
| Compound Name | 2-amino-N-(1,2-diphenylpropan-2-yl)acetamide;but-2-enedioic acid |
|---|---|
| PubChem CID | 3088651 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-amino-N-(1,2-diphenylpropan-2-yl)acetamide;but-2-enedioic acid |
| SMILES | CC(Cc1ccccc1)(NC(=O)CN)c1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H20N2O.C4H4O4/c1-17(19-16(20)13-18,15-10-6-3-7-11-15)12-14-8-4-2-5-9-14;5-3(6)1-2-4(7)8/h2-11H,12-13,18H2,1H3,(H,19,20);1-2H,(H,5,6)(H,7,8) |
| InChIKey | RHRGTPCMGDATRY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|