C23H25F3N2O5 — CID 70393278
(Z)-but-2-enedioic acid;2-(dimethylamino)-N-(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)acetamide (PubChem CID 70393278) has the molecular formula C23H25F3N2O5 and a molecular weight of 466.46 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-(dimethylamino)-N-(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)acetamide.
| Compound Name | (Z)-but-2-enedioic acid;2-(dimethylamino)-N-(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 70393278 |
| Molecular Formula | C23H25F3N2O5 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-(dimethylamino)-N-(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)acetamide |
| SMILES | CN(C)CC(=O)NC(Cc1ccccc1)(c1ccccc1)C(F)(F)F.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H21F3N2O.C4H4O4/c1-24(2)14-17(25)23-18(19(20,21)22,16-11-7-4-8-12-16)13-15-9-5-3-6-10-15;5-3(6)1-2-4(7)8/h3-12H,13-14H2,1-2H3,(H,23,25);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | IEBOATAWIZGFMN-BTJKTKAUSA-N |
| XLogP | 3.08 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|