C42H42F6N4O6 — CID 88631089
bis[1-(dimethylamino)-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate (PubChem CID 88631089) has the molecular formula C42H42F6N4O6 and a molecular weight of 812.81 g/mol. Its IUPAC name is bis[1-(dimethylamino)-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate.
| Compound Name | bis[1-(dimethylamino)-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 88631089 |
| Molecular Formula | C42H42F6N4O6 |
| Molecular Weight | 812.81 g/mol |
| Exact Mass | 812.30 |
| IUPAC Name | bis[1-(dimethylamino)-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate |
| SMILES | CN(C)C(OC(=O)/C=C\C(=O)OC(C(=O)NC(Cc1ccccc1)(c1ccccc1)C(F)(F)F)N(C)C)C(=O)NC(Cc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C42H42F6N4O6/c1-51(2)37(35(55)49-39(41(43,44)45,31-21-13-7-14-22-31)27-29-17-9-5-10-18-29)57-33(53)25-26-34(54)58-38(52(3)4)36(56)50-40(42(46,47)48,32-23-15-8-16-24-32)28-30-19-11-6-12-20-30/h5-26,37-38H,27-28H2,1-4H3,(H,49,55)(H,50,56)/b26-25- |
| InChIKey | UQBQLRPOARSVII-QPLCGJKRSA-N |
| XLogP | 6.04 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.81 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|