C34H36N4O6S2 — CID 67684535
bis[1-amino-2-oxo-2-[(1-phenyl-2-thiophen-2-ylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate (PubChem CID 67684535) has the molecular formula C34H36N4O6S2 and a molecular weight of 660.82 g/mol. Its IUPAC name is bis[1-amino-2-oxo-2-[(1-phenyl-2-thiophen-2-ylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate.
| Compound Name | bis[1-amino-2-oxo-2-[(1-phenyl-2-thiophen-2-ylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 67684535 |
| Molecular Formula | C34H36N4O6S2 |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | bis[1-amino-2-oxo-2-[(1-phenyl-2-thiophen-2-ylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate |
| SMILES | CC(Cc1ccccc1)(NC(=O)C(N)OC(=O)/C=C\C(=O)OC(N)C(=O)NC(C)(Cc1ccccc1)c1cccs1)c1cccs1 |
| InChI | InChI=1S/C34H36N4O6S2/c1-33(25-15-9-19-45-25,21-23-11-5-3-6-12-23)37-31(41)29(35)43-27(39)17-18-28(40)44-30(36)32(42)38-34(2,26-16-10-20-46-26)22-24-13-7-4-8-14-24/h3-20,29-30H,21-22,35-36H2,1-2H3,(H,37,41)(H,38,42)/b18-17- |
| InChIKey | UIUCTJRQSHQDTN-ZCXUNETKSA-N |
| XLogP | 3.87 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|