C38H38Cl2N4O6 — CID 67712439
bis[1-amino-2-[[1-(2-chlorophenyl)-2-phenylpropan-2-yl]amino]-2-oxoethyl] (Z)-but-2-enedioate (PubChem CID 67712439) has the molecular formula C38H38Cl2N4O6 and a molecular weight of 717.65 g/mol. Its IUPAC name is bis[1-amino-2-[[1-(2-chlorophenyl)-2-phenylpropan-2-yl]amino]-2-oxoethyl] (Z)-but-2-enedioate.
| Compound Name | bis[1-amino-2-[[1-(2-chlorophenyl)-2-phenylpropan-2-yl]amino]-2-oxoethyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 67712439 |
| Molecular Formula | C38H38Cl2N4O6 |
| Molecular Weight | 717.65 g/mol |
| Exact Mass | 716.22 |
| IUPAC Name | bis[1-amino-2-[[1-(2-chlorophenyl)-2-phenylpropan-2-yl]amino]-2-oxoethyl] (Z)-but-2-enedioate |
| SMILES | CC(Cc1ccccc1Cl)(NC(=O)C(N)OC(=O)/C=C\C(=O)OC(N)C(=O)NC(C)(Cc1ccccc1Cl)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H38Cl2N4O6/c1-37(27-15-5-3-6-16-27,23-25-13-9-11-19-29(25)39)43-35(47)33(41)49-31(45)21-22-32(46)50-34(42)36(48)44-38(2,28-17-7-4-8-18-28)24-26-14-10-12-20-30(26)40/h3-22,33-34H,23-24,41-42H2,1-2H3,(H,43,47)(H,44,48)/b22-21- |
| InChIKey | RUCHJOGAXQWYRS-DQRAZIAOSA-N |
| XLogP | 5.05 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|