C38H34F6N4O6 — CID 88630700
bis[1-amino-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate (PubChem CID 88630700) has the molecular formula C38H34F6N4O6 and a molecular weight of 756.70 g/mol. Its IUPAC name is bis[1-amino-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate.
| Compound Name | bis[1-amino-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 88630700 |
| Molecular Formula | C38H34F6N4O6 |
| Molecular Weight | 756.70 g/mol |
| Exact Mass | 756.24 |
| IUPAC Name | bis[1-amino-2-oxo-2-[(1,1,1-trifluoro-2,3-diphenylpropan-2-yl)amino]ethyl] (Z)-but-2-enedioate |
| SMILES | NC(OC(=O)/C=C\C(=O)OC(N)C(=O)NC(Cc1ccccc1)(c1ccccc1)C(F)(F)F)C(=O)NC(Cc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C38H34F6N4O6/c39-37(40,41)35(27-17-9-3-10-18-27,23-25-13-5-1-6-14-25)47-33(51)31(45)53-29(49)21-22-30(50)54-32(46)34(52)48-36(38(42,43)44,28-19-11-4-12-20-28)24-26-15-7-2-8-16-26/h1-22,31-32H,23-24,45-46H2,(H,47,51)(H,48,52)/b22-21- |
| InChIKey | NOXIEJCELWPNTO-DQRAZIAOSA-N |
| XLogP | 4.83 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.70 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|