C11H12F3NO2 — CID 10922854
methyl (2R)-2-amino-2-benzyl-3,3,3-trifluoropropanoate (PubChem CID 10922854) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is methyl (2R)-2-amino-2-benzyl-3,3,3-trifluoropropanoate.
| Compound Name | methyl (2R)-2-amino-2-benzyl-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 10922854 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | methyl (2R)-2-amino-2-benzyl-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)[C@](N)(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO2/c1-17-9(16)10(15,11(12,13)14)7-8-5-3-2-4-6-8/h2-6H,7,15H2,1H3/t10-/m1/s1 |
| InChIKey | XQERQOFFMFOSES-SNVBAGLBSA-N |
| XLogP | 1.66 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |